C14H18N2O2 — CID 97101796
4-[2-[[(2R,3S)-2-methyloxolan-3-yl]amino]ethoxy]benzonitrile (PubChem CID 97101796) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[2-[[(2R,3S)-2-methyloxolan-3-yl]amino]ethoxy]benzonitrile.
| Compound Name | 4-[2-[[(2R,3S)-2-methyloxolan-3-yl]amino]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 97101796 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-[2-[[(2R,3S)-2-methyloxolan-3-yl]amino]ethoxy]benzonitrile |
| SMILES | C[C@H]1OCC[C@@H]1NCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-11-14(6-8-17-11)16-7-9-18-13-4-2-12(10-15)3-5-13/h2-5,11,14,16H,6-9H2,1H3/t11-,14+/m1/s1 |
| InChIKey | WTDSKXBKXRGOMX-RISCZKNCSA-N |
| XLogP | 1.70 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|