C13H20N4O2S — CID 97102063
4-cyano-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butane-1-sulfonamide (PubChem CID 97102063) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-cyano-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butane-1-sulfonamide.
| Compound Name | 4-cyano-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 97102063 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-cyano-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butane-1-sulfonamide |
| SMILES | Cc1cn2c(n1)CC[C@@H](NS(=O)(=O)CCCCC#N)C2 |
| InChI | InChI=1S/C13H20N4O2S/c1-11-9-17-10-12(5-6-13(17)15-11)16-20(18,19)8-4-2-3-7-14/h9,12,16H,2-6,8,10H2,1H3/t12-/m1/s1 |
| InChIKey | ZRBPLSQGSOATGK-GFCCVEGCSA-N |
| XLogP | 1.12 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|