C17H23N3O2 — CID 97103014
(3R)-3-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-N-ethylpyrrolidine-1-carboxamide (PubChem CID 97103014) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R)-3-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-N-ethylpyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-N-ethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97103014 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3R)-3-[[(1S)-1-(1-benzofuran-2-yl)ethyl]amino]-N-ethylpyrrolidine-1-carboxamide |
| SMILES | CCNC(=O)N1CC[C@@H](N[C@@H](C)c2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-18-17(21)20-9-8-14(11-20)19-12(2)16-10-13-6-4-5-7-15(13)22-16/h4-7,10,12,14,19H,3,8-9,11H2,1-2H3,(H,18,21)/t12-,14+/m0/s1 |
| InChIKey | VSGKLYJEPBSIMP-GXTWGEPZSA-N |
| XLogP | 2.89 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |