C16H26N2O2S2 — CID 97107832
1-methylsulfonyl-N-[(2R)-1-phenylsulfanylbutan-2-yl]piperidin-4-amine (PubChem CID 97107832) has the molecular formula C16H26N2O2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[(2R)-1-phenylsulfanylbutan-2-yl]piperidin-4-amine.
| Compound Name | 1-methylsulfonyl-N-[(2R)-1-phenylsulfanylbutan-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 97107832 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-methylsulfonyl-N-[(2R)-1-phenylsulfanylbutan-2-yl]piperidin-4-amine |
| SMILES | CC[C@H](CSc1ccccc1)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H26N2O2S2/c1-3-14(13-21-16-7-5-4-6-8-16)17-15-9-11-18(12-10-15)22(2,19)20/h4-8,14-15,17H,3,9-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | VRXIHZGJEWDMNL-CQSZACIVSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |