C17H23N3OS — CID 97109220
1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-(quinolin-4-ylmethyl)urea (PubChem CID 97109220) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-(quinolin-4-ylmethyl)urea.
| Compound Name | 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-(quinolin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 97109220 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-methyl-1-[(2R)-1-methylsulfanylbutan-2-yl]-3-(quinolin-4-ylmethyl)urea |
| SMILES | CC[C@H](CSC)N(C)C(=O)NCc1ccnc2ccccc12 |
| InChI | InChI=1S/C17H23N3OS/c1-4-14(12-22-3)20(2)17(21)19-11-13-9-10-18-16-8-6-5-7-15(13)16/h5-10,14H,4,11-12H2,1-3H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | DIJSJMLNULFXBL-CQSZACIVSA-N |
| XLogP | 3.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |