About (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine
(3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine (PubChem CID 97109365) has the molecular formula C8H4ClF3O2
and a molecular weight of 224.57 g/mol. Its IUPAC name is (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine.
Molecular Properties
| Compound Name | (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine |
| PubChem CID | 97109365 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.57 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine |
| SMILES | F[C@H]1Oc2cc(Cl)ccc2OC1(F)F |
| InChI | InChI=1S/C8H4ClF3O2/c9-4-1-2-5-6(3-4)13-7(10)8(11,12)14-5/h1-3,7H/t7-/m0/s1 |
| InChIKey | WHQOTEIXXRDIOO-ZETCQYMHSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine?
The IUPAC name of (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine (CID 97109365) is (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine.
What is the SMILES notation for (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine?
The canonical SMILES for (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine is F[C@H]1Oc2cc(Cl)ccc2OC1(F)F.
What is the InChIKey of (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine?
The InChIKey is WHQOTEIXXRDIOO-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H4ClF3O2/c9-4-1-2-5-6(3-4)13-7(10)8(11,12)14-5/h1-3,7H/t7-/m0/s1.
What are the key properties of (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine?
(3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine has a molecular weight of 224.57 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-chloro-2,2,3-trifluoro-3H-1,4-benzodioxine is sourced from PubChem (CID 97109365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).