C20H28FN3O3 — CID 97110125
1-[2-[(3R)-3-[(4-fluorophenoxy)methyl]piperidin-1-yl]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 97110125) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[2-[(3R)-3-[(4-fluorophenoxy)methyl]piperidin-1-yl]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(3R)-3-[(4-fluorophenoxy)methyl]piperidin-1-yl]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 97110125 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[2-[(3R)-3-[(4-fluorophenoxy)methyl]piperidin-1-yl]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC(=O)N2CCC[C@@H](COc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C20H28FN3O3/c21-17-3-5-18(6-4-17)27-14-15-2-1-9-24(12-15)19(25)13-23-10-7-16(8-11-23)20(22)26/h3-6,15-16H,1-2,7-14H2,(H2,22,26)/t15-/m1/s1 |
| InChIKey | OXYOPGIHBFUGEM-OAHLLOKOSA-N |
| XLogP | 1.64 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |