About (1S)-1-fluoro-2,3-dihydro-1H-isoindole
(1S)-1-fluoro-2,3-dihydro-1H-isoindole (PubChem CID 97110854) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is (1S)-1-fluoro-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | (1S)-1-fluoro-2,3-dihydro-1H-isoindole |
| PubChem CID | 97110854 |
| Molecular Formula | C8H8FN |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (1S)-1-fluoro-2,3-dihydro-1H-isoindole |
| SMILES | F[C@@H]1NCc2ccccc21 |
| InChI | InChI=1S/C8H8FN/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,8,10H,5H2/t8-/m1/s1 |
| InChIKey | QHHIRXCIZQLEDO-MRVPVSSYSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-fluoro-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-fluoro-2,3-dihydro-1H-isoindole?
The IUPAC name of (1S)-1-fluoro-2,3-dihydro-1H-isoindole (CID 97110854) is (1S)-1-fluoro-2,3-dihydro-1H-isoindole.
What is the SMILES notation for (1S)-1-fluoro-2,3-dihydro-1H-isoindole?
The canonical SMILES for (1S)-1-fluoro-2,3-dihydro-1H-isoindole is F[C@@H]1NCc2ccccc21.
What is the InChIKey of (1S)-1-fluoro-2,3-dihydro-1H-isoindole?
The InChIKey is QHHIRXCIZQLEDO-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H8FN/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,8,10H,5H2/t8-/m1/s1.
What are the key properties of (1S)-1-fluoro-2,3-dihydro-1H-isoindole?
(1S)-1-fluoro-2,3-dihydro-1H-isoindole has a molecular weight of 137.16 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-fluoro-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 97110854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).