About 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea
1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea (PubChem CID 971111) has the molecular formula C15H14F2N2O3
and a molecular weight of 308.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea |
| PubChem CID | 971111 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(F)cc2F)cc(OC)c1 |
| InChI | InChI=1S/C15H14F2N2O3/c1-21-11-6-10(7-12(8-11)22-2)18-15(20)19-14-4-3-9(16)5-13(14)17/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | WVVWPWASOSLGOM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea?
The IUPAC name of 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea (CID 971111) is 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea.
What is the SMILES notation for 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea?
The canonical SMILES for 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea is COc1cc(NC(=O)Nc2ccc(F)cc2F)cc(OC)c1.
What is the InChIKey of 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea?
The InChIKey is WVVWPWASOSLGOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O3/c1-21-11-6-10(7-12(8-11)22-2)18-15(20)19-14-4-3-9(16)5-13(14)17/h3-8H,1-2H3,(H2,18,19,20).
What are the key properties of 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea?
1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea has a molecular weight of 308.28 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-3-(3,5-dimethoxyphenyl)urea is sourced from PubChem (CID 971111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).