C21H20N4O — CID 97112186
4-[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidine-1-carbonyl]benzonitrile (PubChem CID 97112186) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidine-1-carbonyl]benzonitrile.
| Compound Name | 4-[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 97112186 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidine-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCC[C@H](Cc3nc4ccccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C21H20N4O/c22-13-15-7-9-17(10-8-15)21(26)25-11-3-4-16(14-25)12-20-23-18-5-1-2-6-19(18)24-20/h1-2,5-10,16H,3-4,11-12,14H2,(H,23,24)/t16-/m1/s1 |
| InChIKey | QOUURVXDQINOKI-MRXNPFEDSA-N |
| XLogP | 3.53 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |