About (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide
(4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide (PubChem CID 97112194) has the molecular formula C10H18FNO2S
and a molecular weight of 235.32 g/mol. Its IUPAC name is (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide.
Molecular Properties
| Compound Name | (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide |
| PubChem CID | 97112194 |
| Molecular Formula | C10H18FNO2S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](CF)[C@@]12CCCNCC2 |
| InChI | InChI=1S/C10H18FNO2S/c11-8-9-2-7-15(13,14)10(9)3-1-5-12-6-4-10/h9,12H,1-8H2/t9-,10-/m0/s1 |
| InChIKey | SPDNMGZPUJEBJQ-UWVGGRQHSA-N |
| XLogP | 0.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide?
The IUPAC name of (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide (CID 97112194) is (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide.
What is the SMILES notation for (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide?
The canonical SMILES for (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide is O=S1(=O)CC[C@@H](CF)[C@@]12CCCNCC2.
What is the InChIKey of (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide?
The InChIKey is SPDNMGZPUJEBJQ-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H18FNO2S/c11-8-9-2-7-15(13,14)10(9)3-1-5-12-6-4-10/h9,12H,1-8H2/t9-,10-/m0/s1.
What are the key properties of (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide?
(4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide has a molecular weight of 235.32 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-(fluoromethyl)-1λ6-thia-9-azaspiro[4.6]undecane 1,1-dioxide is sourced from PubChem (CID 97112194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).