About 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine
6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine (PubChem CID 97113429) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine |
| PubChem CID | 97113429 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N(C)C[C@H]2CCCCO2)c1C |
| InChI | InChI=1S/C14H24N4O/c1-4-12-10(2)13(17-14(15)16-12)18(3)9-11-7-5-6-8-19-11/h11H,4-9H2,1-3H3,(H2,15,16,17)/t11-/m1/s1 |
| InChIKey | ZRMYCWYZXWFRMC-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine?
The IUPAC name of 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine (CID 97113429) is 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine?
The canonical SMILES for 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine is CCc1nc(N)nc(N(C)C[C@H]2CCCCO2)c1C.
What is the InChIKey of 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine?
The InChIKey is ZRMYCWYZXWFRMC-LLVKDONJSA-N. The full InChI is InChI=1S/C14H24N4O/c1-4-12-10(2)13(17-14(15)16-12)18(3)9-11-7-5-6-8-19-11/h11H,4-9H2,1-3H3,(H2,15,16,17)/t11-/m1/s1.
What are the key properties of 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine?
6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine has a molecular weight of 264.37 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-N,5-dimethyl-4-N-[[(2R)-oxan-2-yl]methyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 97113429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).