C14H16ClN3O — CID 97114326
1-[(3aR,7aS)-3-(4-chlorophenyl)-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 97114326) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-[(3aR,7aS)-3-(4-chlorophenyl)-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(3aR,7aS)-3-(4-chlorophenyl)-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 97114326 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(3aR,7aS)-3-(4-chlorophenyl)-1,3a,4,6,7,7a-hexahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H]2NN=C(c3ccc(Cl)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H16ClN3O/c1-9(19)18-7-6-13-12(8-18)14(17-16-13)10-2-4-11(15)5-3-10/h2-5,12-13,16H,6-8H2,1H3/t12-,13+/m1/s1 |
| InChIKey | RRODEUOCUNUAHE-OLZOCXBDSA-N |
| XLogP | 1.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |