C17H28N2O2S — CID 97114533
(6S)-2-cyclopropyl-8-(3-ethylsulfanylpropanoyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 97114533) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (6S)-2-cyclopropyl-8-(3-ethylsulfanylpropanoyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6S)-2-cyclopropyl-8-(3-ethylsulfanylpropanoyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97114533 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (6S)-2-cyclopropyl-8-(3-ethylsulfanylpropanoyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCSCCC(=O)N1CCC[C@]2(CCC(=O)N(C3CC3)C2)C1 |
| InChI | InChI=1S/C17H28N2O2S/c1-2-22-11-7-15(20)18-10-3-8-17(12-18)9-6-16(21)19(13-17)14-4-5-14/h14H,2-13H2,1H3/t17-/m0/s1 |
| InChIKey | XKWDWHDAXGUFJB-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|