C17H25N5O3 — CID 97115371
N-cyclohexyl-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrazol-4-yl)methyl]propanamide (PubChem CID 97115371) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-cyclohexyl-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrazol-4-yl)methyl]propanamide.
| Compound Name | N-cyclohexyl-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 97115371 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-cyclohexyl-3-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrazol-4-yl)methyl]propanamide |
| SMILES | Cn1cc(CN(C(=O)CC[C@H]2NC(=O)NC2=O)C2CCCCC2)cn1 |
| InChI | InChI=1S/C17H25N5O3/c1-21-10-12(9-18-21)11-22(13-5-3-2-4-6-13)15(23)8-7-14-16(24)20-17(25)19-14/h9-10,13-14H,2-8,11H2,1H3,(H2,19,20,24,25)/t14-/m1/s1 |
| InChIKey | DEKFHDZCGQKGEW-CQSZACIVSA-N |
| XLogP | 1.07 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|