C19H22N2O2 — CID 97116698
2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(3-pyridin-3-yloxypropyl)acetamide (PubChem CID 97116698) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(3-pyridin-3-yloxypropyl)acetamide.
| Compound Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(3-pyridin-3-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 97116698 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(3-pyridin-3-yloxypropyl)acetamide |
| SMILES | O=C(C[C@H]1CCc2ccccc21)NCCCOc1cccnc1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(13-16-9-8-15-5-1-2-7-18(15)16)21-11-4-12-23-17-6-3-10-20-14-17/h1-3,5-7,10,14,16H,4,8-9,11-13H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | OLDBDNSUABZAIR-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|