C17H17ClN4O — CID 97117416
8-chloro-2-[[[(2R)-1-pyrazin-2-ylpropan-2-yl]amino]methyl]-1H-quinolin-4-one (PubChem CID 97117416) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 8-chloro-2-[[[(2R)-1-pyrazin-2-ylpropan-2-yl]amino]methyl]-1H-quinolin-4-one.
| Compound Name | 8-chloro-2-[[[(2R)-1-pyrazin-2-ylpropan-2-yl]amino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 97117416 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 8-chloro-2-[[[(2R)-1-pyrazin-2-ylpropan-2-yl]amino]methyl]-1H-quinolin-4-one |
| SMILES | C[C@H](Cc1cnccn1)NCc1cc(=O)c2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C17H17ClN4O/c1-11(7-12-9-19-5-6-20-12)21-10-13-8-16(23)14-3-2-4-15(18)17(14)22-13/h2-6,8-9,11,21H,7,10H2,1H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | QWGHNVHVKSTQCN-LLVKDONJSA-N |
| XLogP | 2.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |