C16H22N6OS — CID 97117904
(5S)-N-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 97117904) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is (5S)-N-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 97117904 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (5S)-N-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H]1CCc2sc(C(=O)NCc3nc(N)nc(N(C)C)n3)cc2C1 |
| InChI | InChI=1S/C16H22N6OS/c1-9-4-5-11-10(6-9)7-12(24-11)14(23)18-8-13-19-15(17)21-16(20-13)22(2)3/h7,9H,4-6,8H2,1-3H3,(H,18,23)(H2,17,19,20,21)/t9-/m0/s1 |
| InChIKey | OKBCWMAAZOWBSP-VIFPVBQESA-N |
| XLogP | 1.64 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |