C22H31N3O — CID 97118674
(5S)-2-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97118674) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is (5S)-2-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-2-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97118674 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | (5S)-2-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C1NCCC[C@@]12CCN(C1CCN(c3ccc4c(c3)CCC4)CC1)C2 |
| InChI | InChI=1S/C22H31N3O/c26-21-22(9-2-11-23-21)10-14-25(16-22)19-7-12-24(13-8-19)20-6-5-17-3-1-4-18(17)15-20/h5-6,15,19H,1-4,7-14,16H2,(H,23,26)/t22-/m0/s1 |
| InChIKey | MJXLPPFEDWHQRX-QFIPXVFZSA-N |
| XLogP | 2.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|