About 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole
4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole (PubChem CID 97118702) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole.
Molecular Properties
| Compound Name | 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole |
| PubChem CID | 97118702 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole |
| SMILES | Cc1cc(Cn2cc([C@H]3CCOC(C)(C)C3)nn2)n[nH]1 |
| InChI | InChI=1S/C14H21N5O/c1-10-6-12(16-15-10)8-19-9-13(17-18-19)11-4-5-20-14(2,3)7-11/h6,9,11H,4-5,7-8H2,1-3H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | MMXDYUBWTAXPMW-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole?
The IUPAC name of 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole (CID 97118702) is 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole.
What is the SMILES notation for 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole?
The canonical SMILES for 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole is Cc1cc(Cn2cc([C@H]3CCOC(C)(C)C3)nn2)n[nH]1.
What is the InChIKey of 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole?
The InChIKey is MMXDYUBWTAXPMW-NSHDSACASA-N. The full InChI is InChI=1S/C14H21N5O/c1-10-6-12(16-15-10)8-19-9-13(17-18-19)11-4-5-20-14(2,3)7-11/h6,9,11H,4-5,7-8H2,1-3H3,(H,15,16)/t11-/m0/s1.
What are the key properties of 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole?
4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole has a molecular weight of 275.36 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S)-2,2-dimethyloxan-4-yl]-1-[(5-methyl-1H-pyrazol-3-yl)methyl]triazole is sourced from PubChem (CID 97118702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).