C19H27NO5 — CID 97119225
1-[(3R)-3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 97119225) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-[(3R)-3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[(3R)-3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 97119225 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[(3R)-3-(1,3-benzodioxol-5-ylmethyl)-3-methylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCC[C@](C)(Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C19H27NO5/c1-19(11-15-4-5-16-17(10-15)25-14-24-16)6-3-7-20(13-19)18(21)12-23-9-8-22-2/h4-5,10H,3,6-9,11-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | DBVJRDLXGOFXMV-LJQANCHMSA-N |
| XLogP | 2.25 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|