C16H23FN4O3 — CID 97120952
(3R)-3-ethyl-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-3-carboxylic acid (PubChem CID 97120952) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is (3R)-3-ethyl-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-ethyl-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97120952 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (3R)-3-ethyl-1-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperidine-3-carboxylic acid |
| SMILES | CC[C@@]1(C(=O)O)CCCN(c2ncc(F)c(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C16H23FN4O3/c1-2-16(14(22)23)4-3-5-21(11-16)15-18-10-12(17)13(19-15)20-6-8-24-9-7-20/h10H,2-9,11H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | LSDGWZAFIMYYQG-MRXNPFEDSA-N |
| XLogP | 1.53 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |