About (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide
(2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide (PubChem CID 97122669) has the molecular formula C18H20F2N4O
and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide.
Molecular Properties
| Compound Name | (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide |
| PubChem CID | 97122669 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide |
| SMILES | CC[C@H](C(=O)NCCc1c(C)[nH]c2c(F)cc(F)cc12)n1cccn1 |
| InChI | InChI=1S/C18H20F2N4O/c1-3-16(24-8-4-6-22-24)18(25)21-7-5-13-11(2)23-17-14(13)9-12(19)10-15(17)20/h4,6,8-10,16,23H,3,5,7H2,1-2H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | IAQOWHQARGNHTK-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide?
The IUPAC name of (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide (CID 97122669) is (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide.
What is the SMILES notation for (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide?
The canonical SMILES for (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide is CC[C@H](C(=O)NCCc1c(C)[nH]c2c(F)cc(F)cc12)n1cccn1.
What is the InChIKey of (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide?
The InChIKey is IAQOWHQARGNHTK-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H20F2N4O/c1-3-16(24-8-4-6-22-24)18(25)21-7-5-13-11(2)23-17-14(13)9-12(19)10-15(17)20/h4,6,8-10,16,23H,3,5,7H2,1-2H3,(H,21,25)/t16-/m1/s1.
What are the key properties of (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide?
(2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide has a molecular weight of 346.38 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-pyrazol-1-ylbutanamide is sourced from PubChem (CID 97122669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).