C17H24N4OS — CID 97123834
(5R)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 97123834) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (5R)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 97123834 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (5R)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nc(C)n(CCCNC(=O)c2cc3c(s2)CC[C@@H](C)C3)n1 |
| InChI | InChI=1S/C17H24N4OS/c1-11-5-6-15-14(9-11)10-16(23-15)17(22)18-7-4-8-21-13(3)19-12(2)20-21/h10-11H,4-9H2,1-3H3,(H,18,22)/t11-/m1/s1 |
| InChIKey | UZQYLCDNDRXVBQ-LLVKDONJSA-N |
| XLogP | 2.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|