C16H26N4O2 — CID 97124144
[4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]-(5-propyl-1H-pyrazol-3-yl)methanone (PubChem CID 97124144) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is [4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]-(5-propyl-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]-(5-propyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97124144 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [4-[[(2S)-oxolan-2-yl]methyl]piperazin-1-yl]-(5-propyl-1H-pyrazol-3-yl)methanone |
| SMILES | CCCc1cc(C(=O)N2CCN(C[C@@H]3CCCO3)CC2)n[nH]1 |
| InChI | InChI=1S/C16H26N4O2/c1-2-4-13-11-15(18-17-13)16(21)20-8-6-19(7-9-20)12-14-5-3-10-22-14/h11,14H,2-10,12H2,1H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | NIPRHDODPIXVDG-AWEZNQCLSA-N |
| XLogP | 1.30 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |