About 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one
2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 97124678) has the molecular formula C17H25N3O2S
and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one |
| PubChem CID | 97124678 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CCC2(CCN(c3nccs3)CC2)CN1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H25N3O2S/c21-15-3-4-17(13-20(15)12-14-2-1-10-22-14)5-8-19(9-6-17)16-18-7-11-23-16/h7,11,14H,1-6,8-10,12-13H2/t14-/m0/s1 |
| InChIKey | ZDLSTLZLBSJPNJ-AWEZNQCLSA-N |
| XLogP | 2.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one?
The IUPAC name of 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one (CID 97124678) is 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one?
The canonical SMILES for 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one is O=C1CCC2(CCN(c3nccs3)CC2)CN1C[C@@H]1CCCO1.
What is the InChIKey of 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one?
The InChIKey is ZDLSTLZLBSJPNJ-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H25N3O2S/c21-15-3-4-17(13-20(15)12-14-2-1-10-22-14)5-8-19(9-6-17)16-18-7-11-23-16/h7,11,14H,1-6,8-10,12-13H2/t14-/m0/s1.
What are the key properties of 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one?
2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one has a molecular weight of 335.47 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-oxolan-2-yl]methyl]-9-(1,3-thiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one is sourced from PubChem (CID 97124678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).