About [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone
[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone (PubChem CID 97125853) has the molecular formula C19H23NO2S
and a molecular weight of 329.47 g/mol. Its IUPAC name is [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone |
| PubChem CID | 97125853 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone |
| SMILES | Cc1scc(C(=O)N2CC(C)(C)[C@@](C)(O)C2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H23NO2S/c1-13-16(14-8-6-5-7-9-14)15(10-23-13)17(21)20-11-18(2,3)19(4,22)12-20/h5-10,22H,11-12H2,1-4H3/t19-/m0/s1 |
| InChIKey | UNQXEYBYXXZSON-IBGZPJMESA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone?
The IUPAC name of [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone (CID 97125853) is [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone.
What is the SMILES notation for [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone?
The canonical SMILES for [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone is Cc1scc(C(=O)N2CC(C)(C)[C@@](C)(O)C2)c1-c1ccccc1.
What is the InChIKey of [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone?
The InChIKey is UNQXEYBYXXZSON-IBGZPJMESA-N. The full InChI is InChI=1S/C19H23NO2S/c1-13-16(14-8-6-5-7-9-14)15(10-23-13)17(21)20-11-18(2,3)19(4,22)12-20/h5-10,22H,11-12H2,1-4H3/t19-/m0/s1.
What are the key properties of [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone?
[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone has a molecular weight of 329.47 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]-(5-methyl-4-phenylthiophen-3-yl)methanone is sourced from PubChem (CID 97125853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).