C18H21ClN2O — CID 97125905
(4-chloro-1-methylpyrrol-2-yl)-[(3S)-3-methyl-3-phenylpiperidin-1-yl]methanone (PubChem CID 97125905) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is (4-chloro-1-methylpyrrol-2-yl)-[(3S)-3-methyl-3-phenylpiperidin-1-yl]methanone.
| Compound Name | (4-chloro-1-methylpyrrol-2-yl)-[(3S)-3-methyl-3-phenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97125905 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (4-chloro-1-methylpyrrol-2-yl)-[(3S)-3-methyl-3-phenylpiperidin-1-yl]methanone |
| SMILES | Cn1cc(Cl)cc1C(=O)N1CCC[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H21ClN2O/c1-18(14-7-4-3-5-8-14)9-6-10-21(13-18)17(22)16-11-15(19)12-20(16)2/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | HSMYAZYHCREVMC-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |