C21H18FN3O2 — CID 97127277
[(3R)-1-(8-fluoroquinoline-2-carbonyl)piperidin-3-yl]-pyridin-3-ylmethanone (PubChem CID 97127277) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is [(3R)-1-(8-fluoroquinoline-2-carbonyl)piperidin-3-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R)-1-(8-fluoroquinoline-2-carbonyl)piperidin-3-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97127277 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [(3R)-1-(8-fluoroquinoline-2-carbonyl)piperidin-3-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)[C@@H]1CCCN(C(=O)c2ccc3cccc(F)c3n2)C1 |
| InChI | InChI=1S/C21H18FN3O2/c22-17-7-1-4-14-8-9-18(24-19(14)17)21(27)25-11-3-6-16(13-25)20(26)15-5-2-10-23-12-15/h1-2,4-5,7-10,12,16H,3,6,11,13H2/t16-/m1/s1 |
| InChIKey | SAPZEBXWENGSPE-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |