C19H23N3O3 — CID 97127538
2-(2-methoxyethoxy)-N-[(5R)-2-phenyl-5,6,7,8-tetrahydroquinazolin-5-yl]acetamide (PubChem CID 97127538) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[(5R)-2-phenyl-5,6,7,8-tetrahydroquinazolin-5-yl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[(5R)-2-phenyl-5,6,7,8-tetrahydroquinazolin-5-yl]acetamide |
|---|---|
| PubChem CID | 97127538 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[(5R)-2-phenyl-5,6,7,8-tetrahydroquinazolin-5-yl]acetamide |
| SMILES | COCCOCC(=O)N[C@@H]1CCCc2nc(-c3ccccc3)ncc21 |
| InChI | InChI=1S/C19H23N3O3/c1-24-10-11-25-13-18(23)21-16-8-5-9-17-15(16)12-20-19(22-17)14-6-3-2-4-7-14/h2-4,6-7,12,16H,5,8-11,13H2,1H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | VGUGVZYWUMZZEA-MRXNPFEDSA-N |
| XLogP | 2.30 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|