C19H26N4O — CID 97128405
(5S)-5-methyl-5-(4-methylpent-3-enyl)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-2-one (PubChem CID 97128405) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-2-one.
| Compound Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 97128405 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (5S)-5-methyl-5-(4-methylpent-3-enyl)-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidin-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)CCC(=O)N(Cc2nnc3ccccn23)C1 |
| InChI | InChI=1S/C19H26N4O/c1-15(2)7-6-10-19(3)11-9-18(24)22(14-19)13-17-21-20-16-8-4-5-12-23(16)17/h4-5,7-8,12H,6,9-11,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | AWRQDVDJIMZINT-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|