About 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one
5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 97128953) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
| PubChem CID | 97128953 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CC[C@H]1C=CCN1C(=O)c1cnc(CSc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C18H19N3O2S/c1-2-13-7-6-10-21(13)18(23)15-11-19-16(20-17(15)22)12-24-14-8-4-3-5-9-14/h3-9,11,13H,2,10,12H2,1H3,(H,19,20,22)/t13-/m0/s1 |
| InChIKey | QHDKXDAHGTXRPM-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one (CID 97128953) is 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one is CC[C@H]1C=CCN1C(=O)c1cnc(CSc2ccccc2)[nH]c1=O.
What is the InChIKey of 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one?
The InChIKey is QHDKXDAHGTXRPM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-2-13-7-6-10-21(13)18(23)15-11-19-16(20-17(15)22)12-24-14-8-4-3-5-9-14/h3-9,11,13H,2,10,12H2,1H3,(H,19,20,22)/t13-/m0/s1.
What are the key properties of 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one?
5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one has a molecular weight of 341.44 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-2-ethyl-2,5-dihydropyrrole-1-carbonyl]-2-(phenylsulfanylmethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 97128953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).