C18H22ClFN2O2 — CID 97130733
(3S)-N-[2-(2-chloro-6-fluorophenyl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 97130733) has the molecular formula C18H22ClFN2O2 and a molecular weight of 352.84 g/mol. Its IUPAC name is (3S)-N-[2-(2-chloro-6-fluorophenyl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(2-chloro-6-fluorophenyl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97130733 |
| Molecular Formula | C18H22ClFN2O2 |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (3S)-N-[2-(2-chloro-6-fluorophenyl)ethyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1c(F)cccc1Cl)[C@H]1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C18H22ClFN2O2/c19-15-6-3-7-16(20)14(15)8-9-21-18(24)12-10-17(23)22(11-12)13-4-1-2-5-13/h3,6-7,12-13H,1-2,4-5,8-11H2,(H,21,24)/t12-/m0/s1 |
| InChIKey | QRTMXWXFYDARHQ-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |