C18H30N2O4 — CID 97132044
(3S)-1-[1-(2-methoxyethyl)piperidine-4-carbonyl]-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97132044) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3S)-1-[1-(2-methoxyethyl)piperidine-4-carbonyl]-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[1-(2-methoxyethyl)piperidine-4-carbonyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97132044 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (3S)-1-[1-(2-methoxyethyl)piperidine-4-carbonyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)CCCN(C(=O)C2CCN(CCOC)CC2)C1 |
| InChI | InChI=1S/C18H30N2O4/c1-3-7-18(17(22)23)8-4-9-20(14-18)16(21)15-5-10-19(11-6-15)12-13-24-2/h3,15H,1,4-14H2,2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | JOPIYQYQYPLKBY-GOSISDBHSA-N |
| XLogP | 1.61 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|