C18H27ClN2O3 — CID 97132051
(3S)-N-[(4-chlorophenyl)methyl]-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carboxamide (PubChem CID 97132051) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is (3S)-N-[(4-chlorophenyl)methyl]-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-[(4-chlorophenyl)methyl]-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97132051 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3S)-N-[(4-chlorophenyl)methyl]-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carboxamide |
| SMILES | COCCC[C@@]1(CO)CCCN(C(=O)NCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H27ClN2O3/c1-24-11-3-9-18(14-22)8-2-10-21(13-18)17(23)20-12-15-4-6-16(19)7-5-15/h4-7,22H,2-3,8-14H2,1H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | XGCIEOLDHATWOI-SFHVURJKSA-N |
| XLogP | 3.05 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|