About N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine
N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine (PubChem CID 97132478) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
| PubChem CID | 97132478 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
| SMILES | COCc1cc(N(C)C[C@H]2COCCO2)ncn1 |
| InChI | InChI=1S/C12H19N3O3/c1-15(6-11-8-17-3-4-18-11)12-5-10(7-16-2)13-9-14-12/h5,9,11H,3-4,6-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | AVMGJVXMTIGYJF-NSHDSACASA-N |
| XLogP | 0.47 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine?
The IUPAC name of N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine (CID 97132478) is N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine.
What is the SMILES notation for N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine?
The canonical SMILES for N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine is COCc1cc(N(C)C[C@H]2COCCO2)ncn1.
What is the InChIKey of N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine?
The InChIKey is AVMGJVXMTIGYJF-NSHDSACASA-N. The full InChI is InChI=1S/C12H19N3O3/c1-15(6-11-8-17-3-4-18-11)12-5-10(7-16-2)13-9-14-12/h5,9,11H,3-4,6-8H2,1-2H3/t11-/m0/s1.
What are the key properties of N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine?
N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine has a molecular weight of 253.30 g/mol, XLogP of 0.47, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-(methoxymethyl)-N-methylpyrimidin-4-amine is sourced from PubChem (CID 97132478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).