C19H24N4 — CID 97133887
(5S)-2-phenyl-N-piperidin-4-yl-5,6,7,8-tetrahydroquinazolin-5-amine (PubChem CID 97133887) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (5S)-2-phenyl-N-piperidin-4-yl-5,6,7,8-tetrahydroquinazolin-5-amine.
| Compound Name | (5S)-2-phenyl-N-piperidin-4-yl-5,6,7,8-tetrahydroquinazolin-5-amine |
|---|---|
| PubChem CID | 97133887 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (5S)-2-phenyl-N-piperidin-4-yl-5,6,7,8-tetrahydroquinazolin-5-amine |
| SMILES | c1ccc(-c2ncc3c(n2)CCC[C@@H]3NC2CCNCC2)cc1 |
| InChI | InChI=1S/C19H24N4/c1-2-5-14(6-3-1)19-21-13-16-17(7-4-8-18(16)23-19)22-15-9-11-20-12-10-15/h1-3,5-6,13,15,17,20,22H,4,7-12H2/t17-/m0/s1 |
| InChIKey | VKWJVBIJSHEJLS-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |