C18H25N3O4 — CID 97133958
(3S)-1-(6-tert-butyl-2-oxo-1H-pyrimidine-4-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97133958) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3S)-1-(6-tert-butyl-2-oxo-1H-pyrimidine-4-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(6-tert-butyl-2-oxo-1H-pyrimidine-4-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97133958 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3S)-1-(6-tert-butyl-2-oxo-1H-pyrimidine-4-carbonyl)-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)CCCN(C(=O)c2cc(C(C)(C)C)[nH]c(=O)n2)C1 |
| InChI | InChI=1S/C18H25N3O4/c1-5-7-18(15(23)24)8-6-9-21(11-18)14(22)12-10-13(17(2,3)4)20-16(25)19-12/h5,10H,1,6-9,11H2,2-4H3,(H,23,24)(H,19,20,25)/t18-/m1/s1 |
| InChIKey | BOXXXZZVKMKYTC-GOSISDBHSA-N |
| XLogP | 1.95 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|