About N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide
N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 97134583) has the molecular formula C18H13FN2O2S
and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 97134583 |
| Molecular Formula | C18H13FN2O2S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)COC2)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H13FN2O2S/c19-14-4-1-11(2-5-14)18-21-16(10-24-18)17(22)20-15-6-3-12-8-23-9-13(12)7-15/h1-7,10H,8-9H2,(H,20,22) |
| InChIKey | RCIYOPCUVBPYHL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide (CID 97134583) is N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1ccc2c(c1)COC2)c1csc(-c2ccc(F)cc2)n1.
What is the InChIKey of N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is RCIYOPCUVBPYHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O2S/c19-14-4-1-11(2-5-14)18-21-16(10-24-18)17(22)20-15-6-3-12-8-23-9-13(12)7-15/h1-7,10H,8-9H2,(H,20,22).
What are the key properties of N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide?
N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 340.38 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydro-2-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 97134583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).