C15H14N4S — CID 971346
4-(2,3-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 971346) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,3-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 971346 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2c(-c3ccncc3)n[nH]c2=S)c1C |
| InChI | InChI=1S/C15H14N4S/c1-10-4-3-5-13(11(10)2)19-14(17-18-15(19)20)12-6-8-16-9-7-12/h3-9H,1-2H3,(H,18,20) |
| InChIKey | PWKBBFJKVBFIJO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|