C21H29N3O2 — CID 97134600
1-benzofuran-5-yl-[4-[(1R)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methanone (PubChem CID 97134600) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-benzofuran-5-yl-[4-[(1R)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methanone.
| Compound Name | 1-benzofuran-5-yl-[4-[(1R)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97134600 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-benzofuran-5-yl-[4-[(1R)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]methanone |
| SMILES | C[C@H](C1CCN(C(=O)c2ccc3occc3c2)CC1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H29N3O2/c1-16(23-12-10-22(2)11-13-23)17-5-8-24(9-6-17)21(25)19-3-4-20-18(15-19)7-14-26-20/h3-4,7,14-17H,5-6,8-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | VBILJDHVVGPSBU-MRXNPFEDSA-N |
| XLogP | 2.92 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |