C21H36N2O3 — CID 97135326
(5S)-7-cyclohexyl-2-(6-methoxyhexanoyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97135326) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is (5S)-7-cyclohexyl-2-(6-methoxyhexanoyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-7-cyclohexyl-2-(6-methoxyhexanoyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97135326 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | (5S)-7-cyclohexyl-2-(6-methoxyhexanoyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | COCCCCCC(=O)N1CC[C@@]2(CCCN(C3CCCCC3)C2=O)C1 |
| InChI | InChI=1S/C21H36N2O3/c1-26-16-7-3-6-11-19(24)22-15-13-21(17-22)12-8-14-23(20(21)25)18-9-4-2-5-10-18/h18H,2-17H2,1H3/t21-/m0/s1 |
| InChIKey | YJVMYCWYJGQWAL-NRFANRHFSA-N |
| XLogP | 3.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|