About 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one
6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one (PubChem CID 97136603) has the molecular formula C16H16FN3OS
and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one |
| PubChem CID | 97136603 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one |
| SMILES | C[C@@H](Cc1cncs1)NCc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C16H16FN3OS/c1-10(4-13-8-18-9-22-13)19-7-12-6-16(21)14-5-11(17)2-3-15(14)20-12/h2-3,5-6,8-10,19H,4,7H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | RBZCNSQNMUFZLJ-JTQLQIEISA-N |
| XLogP | 2.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one?
The IUPAC name of 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one (CID 97136603) is 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one.
What is the SMILES notation for 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one?
The canonical SMILES for 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one is C[C@@H](Cc1cncs1)NCc1cc(=O)c2cc(F)ccc2[nH]1.
What is the InChIKey of 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one?
The InChIKey is RBZCNSQNMUFZLJ-JTQLQIEISA-N. The full InChI is InChI=1S/C16H16FN3OS/c1-10(4-13-8-18-9-22-13)19-7-12-6-16(21)14-5-11(17)2-3-15(14)20-12/h2-3,5-6,8-10,19H,4,7H2,1H3,(H,20,21)/t10-/m0/s1.
What are the key properties of 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one?
6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one has a molecular weight of 317.39 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-[[[(2S)-1-(1,3-thiazol-5-yl)propan-2-yl]amino]methyl]-1H-quinolin-4-one is sourced from PubChem (CID 97136603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).