C16H19FN2O — CID 97136684
(1R)-1-(2-fluorophenyl)-2-[methyl-[(1R)-1-pyridin-2-ylethyl]amino]ethanol (PubChem CID 97136684) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is (1R)-1-(2-fluorophenyl)-2-[methyl-[(1R)-1-pyridin-2-ylethyl]amino]ethanol.
| Compound Name | (1R)-1-(2-fluorophenyl)-2-[methyl-[(1R)-1-pyridin-2-ylethyl]amino]ethanol |
|---|---|
| PubChem CID | 97136684 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1R)-1-(2-fluorophenyl)-2-[methyl-[(1R)-1-pyridin-2-ylethyl]amino]ethanol |
| SMILES | C[C@H](c1ccccn1)N(C)C[C@H](O)c1ccccc1F |
| InChI | InChI=1S/C16H19FN2O/c1-12(15-9-5-6-10-18-15)19(2)11-16(20)13-7-3-4-8-14(13)17/h3-10,12,16,20H,11H2,1-2H3/t12-,16+/m1/s1 |
| InChIKey | VNRSHCIVJBTVTG-WBMJQRKESA-N |
| XLogP | 2.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |