C22H32N2O2 — CID 97136898
2-benzyl-9-[[(2R)-oxan-2-yl]methyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 97136898) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-benzyl-9-[[(2R)-oxan-2-yl]methyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-benzyl-9-[[(2R)-oxan-2-yl]methyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 97136898 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-benzyl-9-[[(2R)-oxan-2-yl]methyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CCC2(CCN(C[C@H]3CCCCO3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O2/c25-21-9-10-22(18-24(21)16-19-6-2-1-3-7-19)11-13-23(14-12-22)17-20-8-4-5-15-26-20/h1-3,6-7,20H,4-5,8-18H2/t20-/m1/s1 |
| InChIKey | DJLBSKHSJBEFGH-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |