About (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one
(5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one (PubChem CID 97137251) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one.
Molecular Properties
| Compound Name | (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one |
| PubChem CID | 97137251 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one |
| SMILES | O=C1CC[C@]2(CCOC2)CN1Cc1ncc2c(n1)CCC2 |
| InChI | InChI=1S/C16H21N3O2/c20-15-4-5-16(6-7-21-11-16)10-19(15)9-14-17-8-12-2-1-3-13(12)18-14/h8H,1-7,9-11H2/t16-/m0/s1 |
| InChIKey | KENUZROOVKAEML-INIZCTEOSA-N |
| XLogP | 1.49 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one?
The IUPAC name of (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one (CID 97137251) is (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one.
What is the SMILES notation for (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one?
The canonical SMILES for (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one is O=C1CC[C@]2(CCOC2)CN1Cc1ncc2c(n1)CCC2.
What is the InChIKey of (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one?
The InChIKey is KENUZROOVKAEML-INIZCTEOSA-N. The full InChI is InChI=1S/C16H21N3O2/c20-15-4-5-16(6-7-21-11-16)10-19(15)9-14-17-8-12-2-1-3-13(12)18-14/h8H,1-7,9-11H2/t16-/m0/s1.
What are the key properties of (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one?
(5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one has a molecular weight of 287.36 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-9-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-ylmethyl)-2-oxa-9-azaspiro[4.5]decan-8-one is sourced from PubChem (CID 97137251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).