C20H27N3S — CID 97137344
2-[(4S)-2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl]-1,3-thiazole (PubChem CID 97137344) has the molecular formula C20H27N3S and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-[(4S)-2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl]-1,3-thiazole.
| Compound Name | 2-[(4S)-2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 97137344 |
| Molecular Formula | C20H27N3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[(4S)-2-ethyl-4-phenyl-2,9-diazaspiro[5.5]undecan-9-yl]-1,3-thiazole |
| SMILES | CCN1C[C@H](c2ccccc2)CC2(CCN(c3nccs3)CC2)C1 |
| InChI | InChI=1S/C20H27N3S/c1-2-22-15-18(17-6-4-3-5-7-17)14-20(16-22)8-11-23(12-9-20)19-21-10-13-24-19/h3-7,10,13,18H,2,8-9,11-12,14-16H2,1H3/t18-/m1/s1 |
| InChIKey | GVEPMESUUMRNRB-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |