C17H17N5O3 — CID 97137408
4-(2,4-dioxoimidazolidin-1-yl)-N-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]benzamide (PubChem CID 97137408) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]benzamide |
|---|---|
| PubChem CID | 97137408 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5R)-4,5,6,7-tetrahydro-1H-indazol-5-yl]benzamide |
| SMILES | O=C1CN(c2ccc(C(=O)N[C@@H]3CCc4[nH]ncc4C3)cc2)C(=O)N1 |
| InChI | InChI=1S/C17H17N5O3/c23-15-9-22(17(25)20-15)13-4-1-10(2-5-13)16(24)19-12-3-6-14-11(7-12)8-18-21-14/h1-2,4-5,8,12H,3,6-7,9H2,(H,18,21)(H,19,24)(H,20,23,25)/t12-/m1/s1 |
| InChIKey | LVCXSPLYWUTXGZ-GFCCVEGCSA-N |
| XLogP | 0.75 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|