C21H29N3O3 — CID 97137685
2-(1-adamantyl)-N-[[(3R)-oxan-3-yl]methyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 97137685) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[(3R)-oxan-3-yl]methyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-(1-adamantyl)-N-[[(3R)-oxan-3-yl]methyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 97137685 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[[(3R)-oxan-3-yl]methyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NC[C@H]1CCCOC1)c1cnc(C23CC4CC(CC(C4)C2)C3)[nH]c1=O |
| InChI | InChI=1S/C21H29N3O3/c25-18(22-10-13-2-1-3-27-12-13)17-11-23-20(24-19(17)26)21-7-14-4-15(8-21)6-16(5-14)9-21/h11,13-16H,1-10,12H2,(H,22,25)(H,23,24,26)/t13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | HNVYYCCYDMNHPH-BUBBNXEVSA-N |
| XLogP | 2.39 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |