C22H27N5O3 — CID 97138494
N-[(4R)-1-(4-tert-butylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 97138494) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(4R)-1-(4-tert-butylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(4R)-1-(4-tert-butylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 97138494 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-[(4R)-1-(4-tert-butylphenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2-(2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC(C)(C)c1ccc(-n2ncc3c2CCC[C@H]3NC(=O)CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C22H27N5O3/c1-22(2,3)14-7-9-15(10-8-14)27-18-6-4-5-17(16(18)11-24-27)25-19(28)13-26-20(29)12-23-21(26)30/h7-11,17H,4-6,12-13H2,1-3H3,(H,23,30)(H,25,28)/t17-/m1/s1 |
| InChIKey | NKJFLKLWPFUEKI-QGZVFWFLSA-N |
| XLogP | 2.22 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|